C21H26N2O4 — CID 145267547
5-formyl-N-methyl-2-oxo-1-[[3-[(Z)-pent-2-en-2-yl]phenyl]methyl]pyridine-3-carboxamide;methanol (PubChem CID 145267547) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-formyl-N-methyl-2-oxo-1-[[3-[(Z)-pent-2-en-2-yl]phenyl]methyl]pyridine-3-carboxamide;methanol.
| Compound Name | 5-formyl-N-methyl-2-oxo-1-[[3-[(Z)-pent-2-en-2-yl]phenyl]methyl]pyridine-3-carboxamide;methanol |
|---|---|
| PubChem CID | 145267547 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 5-formyl-N-methyl-2-oxo-1-[[3-[(Z)-pent-2-en-2-yl]phenyl]methyl]pyridine-3-carboxamide;methanol |
| SMILES | CC/C=C(/C)c1cccc(Cn2cc(C=O)cc(C(=O)NC)c2=O)c1.CO |
| InChI | InChI=1S/C20H22N2O3.CH4O/c1-4-6-14(2)17-8-5-7-15(9-17)11-22-12-16(13-23)10-18(20(22)25)19(24)21-3;1-2/h5-10,12-13H,4,11H2,1-3H3,(H,21,24);2H,1H3/b14-6-; |
| InChIKey | SDAPQPMUZISWFT-WQMRFYCQSA-N |
| XLogP | 2.49 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|