C23H30N4O3 — CID 145267553
1-benzyl-5-formyl-N-methyl-2-oxopyridine-3-carboxamide;2-N-methylspiro[3.3]heptane-2,6-diamine (PubChem CID 145267553) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-benzyl-5-formyl-N-methyl-2-oxopyridine-3-carboxamide;2-N-methylspiro[3.3]heptane-2,6-diamine.
| Compound Name | 1-benzyl-5-formyl-N-methyl-2-oxopyridine-3-carboxamide;2-N-methylspiro[3.3]heptane-2,6-diamine |
|---|---|
| PubChem CID | 145267553 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-benzyl-5-formyl-N-methyl-2-oxopyridine-3-carboxamide;2-N-methylspiro[3.3]heptane-2,6-diamine |
| SMILES | CNC(=O)c1cc(C=O)cn(Cc2ccccc2)c1=O.CNC1CC2(CC(N)C2)C1 |
| InChI | InChI=1S/C15H14N2O3.C8H16N2/c1-16-14(19)13-7-12(10-18)9-17(15(13)20)8-11-5-3-2-4-6-11;1-10-7-4-8(5-7)2-6(9)3-8/h2-7,9-10H,8H2,1H3,(H,16,19);6-7,10H,2-5,9H2,1H3 |
| InChIKey | WDPVNHUYDMZPEZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|