C11H26N4 — CID 145267739
ethane;N'-[(E)-2-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]ethanimidamide (PubChem CID 145267739) has the molecular formula C11H26N4 and a molecular weight of 214.36 g/mol. Its IUPAC name is ethane;N'-[(E)-2-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]ethanimidamide.
| Compound Name | ethane;N'-[(E)-2-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]ethanimidamide |
|---|---|
| PubChem CID | 145267739 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | ethane;N'-[(E)-2-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]ethanimidamide |
| SMILES | CC.CNCCN(C)/C(C)=C/N=C(\C)N |
| InChI | InChI=1S/C9H20N4.C2H6/c1-8(7-12-9(2)10)13(4)6-5-11-3;1-2/h7,11H,5-6H2,1-4H3,(H2,10,12);1-2H3/b8-7+; |
| InChIKey | MMEICEMJAXONAD-USRGLUTNSA-N |
| XLogP | 1.40 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|