C10H18N4 — CID 142175218
N'-[2-[(1-methyl-2H-pyridin-4-yl)amino]ethyl]ethanimidamide (PubChem CID 142175218) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-[2-[(1-methyl-2H-pyridin-4-yl)amino]ethyl]ethanimidamide.
| Compound Name | N'-[2-[(1-methyl-2H-pyridin-4-yl)amino]ethyl]ethanimidamide |
|---|---|
| PubChem CID | 142175218 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-[2-[(1-methyl-2H-pyridin-4-yl)amino]ethyl]ethanimidamide |
| SMILES | C/C(N)=N\CCNC1=CCN(C)C=C1 |
| InChI | InChI=1S/C10H18N4/c1-9(11)12-5-6-13-10-3-7-14(2)8-4-10/h3-4,7,13H,5-6,8H2,1-2H3,(H2,11,12) |
| InChIKey | YVQVCEJDHOCGRC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|