About (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide
(2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide (PubChem CID 137215412) has the molecular formula C16H28N6
and a molecular weight of 304.44 g/mol. Its IUPAC name is (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide.
Molecular Properties
| Compound Name | (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide |
| PubChem CID | 137215412 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide |
| SMILES | CCCN1CCN(CC/N=C(N)/C(N)=C2/C=CC=CN2)CC1 |
| InChI | InChI=1S/C16H28N6/c1-2-8-21-10-12-22(13-11-21)9-7-20-16(18)15(17)14-5-3-4-6-19-14/h3-6,19H,2,7-13,17H2,1H3,(H2,18,20)/b15-14+ |
| InChIKey | QSMJHDYTRIQYCQ-CCEZHUSRSA-N |
| XLogP | 0.21 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide?
The IUPAC name of (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide (CID 137215412) is (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide.
What is the SMILES notation for (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide?
The canonical SMILES for (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide is CCCN1CCN(CC/N=C(N)/C(N)=C2/C=CC=CN2)CC1.
What is the InChIKey of (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide?
The InChIKey is QSMJHDYTRIQYCQ-CCEZHUSRSA-N. The full InChI is InChI=1S/C16H28N6/c1-2-8-21-10-12-22(13-11-21)9-7-20-16(18)15(17)14-5-3-4-6-19-14/h3-6,19H,2,7-13,17H2,1H3,(H2,18,20)/b15-14+.
What are the key properties of (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide?
(2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide has a molecular weight of 304.44 g/mol, XLogP of 0.21, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-amino-N'-[2-(4-propylpiperazin-1-yl)ethyl]-2-(1H-pyridin-2-ylidene)ethanimidamide is sourced from PubChem (CID 137215412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).