C10H18N4 — CID 171660727
N'-[(1E)-2-piperazin-1-ylbuta-1,3-dienyl]ethanimidamide (PubChem CID 171660727) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-[(1E)-2-piperazin-1-ylbuta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1E)-2-piperazin-1-ylbuta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 171660727 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-[(1E)-2-piperazin-1-ylbuta-1,3-dienyl]ethanimidamide |
| SMILES | C=C/C(=C\N=C(/C)N)N1CCNCC1 |
| InChI | InChI=1S/C10H18N4/c1-3-10(8-13-9(2)11)14-6-4-12-5-7-14/h3,8,12H,1,4-7H2,2H3,(H2,11,13)/b10-8+ |
| InChIKey | UAYXADUJSYBPOD-CSKARUKUSA-N |
| XLogP | 0.30 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|