C13H13BrF4NO+ — CID 145268162
[(1Z,3E)-1-[2-bromo-5-(trifluoromethyl)phenyl]-4-fluoropenta-1,3-dienyl]-methoxyazanium (PubChem CID 145268162) has the molecular formula C13H13BrF4NO+ and a molecular weight of 355.15 g/mol. Its IUPAC name is [(1Z,3E)-1-[2-bromo-5-(trifluoromethyl)phenyl]-4-fluoropenta-1,3-dienyl]-methoxyazanium.
| Compound Name | [(1Z,3E)-1-[2-bromo-5-(trifluoromethyl)phenyl]-4-fluoropenta-1,3-dienyl]-methoxyazanium |
|---|---|
| PubChem CID | 145268162 |
| Molecular Formula | C13H13BrF4NO+ |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | [(1Z,3E)-1-[2-bromo-5-(trifluoromethyl)phenyl]-4-fluoropenta-1,3-dienyl]-methoxyazanium |
| SMILES | CO[NH2+]/C(=C\C=C(/C)F)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C13H12BrF4NO/c1-8(15)3-6-12(19-20-2)10-7-9(13(16,17)18)4-5-11(10)14/h3-7,19H,1-2H3/p+1/b8-3+,12-6- |
| InChIKey | ZROPSMMKJKGVDT-KGMYDQKRSA-O |
| XLogP | 3.81 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|