About 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene
1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene (PubChem CID 145268237) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene.
Analyze 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene?
The IUPAC name of 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene (CID 145268237) is 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene.
What is the SMILES notation for 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene?
The canonical SMILES for 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene is C=CC1=C(C=C)C(=C)C=CC1.
What is the InChIKey of 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene?
The InChIKey is DILBXLLEIZMEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-4-10-8-6-7-9(3)11(10)5-2/h4-7H,1-3,8H2.
What are the key properties of 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene?
1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene has a molecular weight of 144.22 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(ethenyl)-3-methylidenecyclohexa-1,4-diene is sourced from PubChem (CID 145268237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).