C10H10S — CID 143333488
2,3-bis(ethenyl)-4-methylidenethiopyran (PubChem CID 143333488) has the molecular formula C10H10S and a molecular weight of 162.26 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-methylidenethiopyran.
| Compound Name | 2,3-bis(ethenyl)-4-methylidenethiopyran |
|---|---|
| PubChem CID | 143333488 |
| Molecular Formula | C10H10S |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 2,3-bis(ethenyl)-4-methylidenethiopyran |
| SMILES | C=CC1=C(C=C)C(=C)C=CS1 |
| InChI | InChI=1S/C10H10S/c1-4-9-8(3)6-7-11-10(9)5-2/h4-7H,1-3H2 |
| InChIKey | LSTYCXQKTBEGBV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |