C10H8O2 — CID 178047667
3,4-bis(ethenyl)-5-methylidenecyclopent-3-ene-1,2-dione (PubChem CID 178047667) has the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-5-methylidenecyclopent-3-ene-1,2-dione.
| Compound Name | 3,4-bis(ethenyl)-5-methylidenecyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 178047667 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 3,4-bis(ethenyl)-5-methylidenecyclopent-3-ene-1,2-dione |
| SMILES | C=CC1=C(C=C)C(=O)C(=O)C1=C |
| InChI | InChI=1S/C10H8O2/c1-4-7-6(3)9(11)10(12)8(7)5-2/h4-5H,1-3H2 |
| InChIKey | CJOIKSABCNLZFK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|