C12H19NO2 — CID 145336115
ethane;3-ethenyl-4-methylpyrrole-2,5-dione;prop-1-ene (PubChem CID 145336115) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is ethane;3-ethenyl-4-methylpyrrole-2,5-dione;prop-1-ene.
| Compound Name | ethane;3-ethenyl-4-methylpyrrole-2,5-dione;prop-1-ene |
|---|---|
| PubChem CID | 145336115 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethane;3-ethenyl-4-methylpyrrole-2,5-dione;prop-1-ene |
| SMILES | C=CC.C=CC1=C(C)C(=O)NC1=O.CC |
| InChI | InChI=1S/C7H7NO2.C3H6.C2H6/c1-3-5-4(2)6(9)8-7(5)10;1-3-2;1-2/h3H,1H2,2H3,(H,8,9,10);3H,1H2,2H3;1-2H3 |
| InChIKey | NVEXTWPPJKBXLY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|