C9H13NO — CID 123297761
4-ethenyl-3-ethyl-2-methyl-1,2-dihydropyrrol-5-one (PubChem CID 123297761) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-ethenyl-3-ethyl-2-methyl-1,2-dihydropyrrol-5-one.
| Compound Name | 4-ethenyl-3-ethyl-2-methyl-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 123297761 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-ethenyl-3-ethyl-2-methyl-1,2-dihydropyrrol-5-one |
| SMILES | C=CC1=C(CC)C(C)NC1=O |
| InChI | InChI=1S/C9H13NO/c1-4-7-6(3)10-9(11)8(7)5-2/h5-6H,2,4H2,1,3H3,(H,10,11) |
| InChIKey | PDCAZLQDUVFTLY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |