C12H9NS — CID 177063992
2-ethenyl-4H-thieno[2,3-b]indole (PubChem CID 177063992) has the molecular formula C12H9NS and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-ethenyl-4H-thieno[2,3-b]indole.
| Compound Name | 2-ethenyl-4H-thieno[2,3-b]indole |
|---|---|
| PubChem CID | 177063992 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-ethenyl-4H-thieno[2,3-b]indole |
| SMILES | C=Cc1cc2c([nH]c3ccccc32)s1 |
| InChI | InChI=1S/C12H9NS/c1-2-8-7-10-9-5-3-4-6-11(9)13-12(10)14-8/h2-7,13H,1H2 |
| InChIKey | KOJLQNMHYSWMHR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |