C10H11I — CID 155001714
1-ethenyl-2-[(E)-2-iodoprop-1-enyl]cyclopenta-1,3-diene (PubChem CID 155001714) has the molecular formula C10H11I and a molecular weight of 258.10 g/mol. Its IUPAC name is 1-ethenyl-2-[(E)-2-iodoprop-1-enyl]cyclopenta-1,3-diene.
| Compound Name | 1-ethenyl-2-[(E)-2-iodoprop-1-enyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 155001714 |
| Molecular Formula | C10H11I |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1-ethenyl-2-[(E)-2-iodoprop-1-enyl]cyclopenta-1,3-diene |
| SMILES | C=CC1=C(/C=C(\C)I)C=CC1 |
| InChI | InChI=1S/C10H11I/c1-3-9-5-4-6-10(9)7-8(2)11/h3-4,6-7H,1,5H2,2H3/b8-7+ |
| InChIKey | XOHQTYHTKBRPPM-BQYQJAHWSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|