C28H35N3O5 — CID 145269327
2-amino-5-(3-formyl-5-hydroxyphenyl)pyridine-3-carboxamide;4-(cyclopentyloxymethyl)-1,2-dimethylbenzene;methanol (PubChem CID 145269327) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-amino-5-(3-formyl-5-hydroxyphenyl)pyridine-3-carboxamide;4-(cyclopentyloxymethyl)-1,2-dimethylbenzene;methanol.
| Compound Name | 2-amino-5-(3-formyl-5-hydroxyphenyl)pyridine-3-carboxamide;4-(cyclopentyloxymethyl)-1,2-dimethylbenzene;methanol |
|---|---|
| PubChem CID | 145269327 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 2-amino-5-(3-formyl-5-hydroxyphenyl)pyridine-3-carboxamide;4-(cyclopentyloxymethyl)-1,2-dimethylbenzene;methanol |
| SMILES | CO.Cc1ccc(COC2CCCC2)cc1C.NC(=O)c1cc(-c2cc(O)cc(C=O)c2)cnc1N |
| InChI | InChI=1S/C14H20O.C13H11N3O3.CH4O/c1-11-7-8-13(9-12(11)2)10-15-14-5-3-4-6-14;14-12-11(13(15)19)4-9(5-16-12)8-1-7(6-17)2-10(18)3-8;1-2/h7-9,14H,3-6,10H2,1-2H3;1-6,18H,(H2,14,16)(H2,15,19);2H,1H3 |
| InChIKey | ZUNNPPDMQPKCFU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 148.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|