C18H25N3O2 — CID 145270847
ethane;methyl 1-(1-benzylpyrazol-3-yl)pyrrolidine-3-carboxylate (PubChem CID 145270847) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is ethane;methyl 1-(1-benzylpyrazol-3-yl)pyrrolidine-3-carboxylate.
| Compound Name | ethane;methyl 1-(1-benzylpyrazol-3-yl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 145270847 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | ethane;methyl 1-(1-benzylpyrazol-3-yl)pyrrolidine-3-carboxylate |
| SMILES | CC.COC(=O)C1CCN(c2ccn(Cc3ccccc3)n2)C1 |
| InChI | InChI=1S/C16H19N3O2.C2H6/c1-21-16(20)14-7-9-18(12-14)15-8-10-19(17-15)11-13-5-3-2-4-6-13;1-2/h2-6,8,10,14H,7,9,11-12H2,1H3;1-2H3 |
| InChIKey | VWGFLUIEFLWZPZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |