C14H15N3 — CID 126655401
1-benzyl-3-(2,5-dihydropyrrol-1-yl)pyrazole (PubChem CID 126655401) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is 1-benzyl-3-(2,5-dihydropyrrol-1-yl)pyrazole.
| Compound Name | 1-benzyl-3-(2,5-dihydropyrrol-1-yl)pyrazole |
|---|---|
| PubChem CID | 126655401 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-benzyl-3-(2,5-dihydropyrrol-1-yl)pyrazole |
| SMILES | C1=CCN(c2ccn(Cc3ccccc3)n2)C1 |
| InChI | InChI=1S/C14H15N3/c1-2-6-13(7-3-1)12-17-11-8-14(15-17)16-9-4-5-10-16/h1-8,11H,9-10,12H2 |
| InChIKey | GCMAWMSFMCGSJV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|