C17H23N3O2 — CID 126655537
(3S,4R)-1-(1-benzylpyrazol-3-yl)-3,4-dimethoxypiperidine (PubChem CID 126655537) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3S,4R)-1-(1-benzylpyrazol-3-yl)-3,4-dimethoxypiperidine.
| Compound Name | (3S,4R)-1-(1-benzylpyrazol-3-yl)-3,4-dimethoxypiperidine |
|---|---|
| PubChem CID | 126655537 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (3S,4R)-1-(1-benzylpyrazol-3-yl)-3,4-dimethoxypiperidine |
| SMILES | CO[C@H]1CN(c2ccn(Cc3ccccc3)n2)CC[C@H]1OC |
| InChI | InChI=1S/C17H23N3O2/c1-21-15-8-10-19(13-16(15)22-2)17-9-11-20(18-17)12-14-6-4-3-5-7-14/h3-7,9,11,15-16H,8,10,12-13H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | UIPTXHFFTGRFOE-CVEARBPZSA-N |
| XLogP | 2.17 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |