C16H21N3O — CID 126655637
(3S)-1-(1-benzylpyrazol-3-yl)-2,2,4,4,5,5,6,6-octadeuterio-3-methylpiperidin-3-ol (PubChem CID 126655637) has the molecular formula C16H21N3O and a molecular weight of 279.41 g/mol. Its IUPAC name is (3S)-1-(1-benzylpyrazol-3-yl)-2,2,4,4,5,5,6,6-octadeuterio-3-methylpiperidin-3-ol.
| Compound Name | (3S)-1-(1-benzylpyrazol-3-yl)-2,2,4,4,5,5,6,6-octadeuterio-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 126655637 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | (3S)-1-(1-benzylpyrazol-3-yl)-2,2,4,4,5,5,6,6-octadeuterio-3-methylpiperidin-3-ol |
| SMILES | [2H]C1([2H])N(c2ccn(Cc3ccccc3)n2)C([2H])([2H])[C@@](C)(O)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C16H21N3O/c1-16(20)9-5-10-18(13-16)15-8-11-19(17-15)12-14-6-3-2-4-7-14/h2-4,6-8,11,20H,5,9-10,12-13H2,1H3/t16-/m0/s1/i5D2,9D2,10D2,13D2 |
| InChIKey | DSZMIMHMAZWSDB-KCYVVSHVSA-N |
| XLogP | 2.28 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |