C30H49NO3 — CID 145271364
(2S,4aS,6aS,6aS,6bR,10S,12aR,14bR)-8a-amino-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,10,11,12,13,14b-dodecahydro-1H-picene-2-carboxylic acid (PubChem CID 145271364) has the molecular formula C30H49NO3 and a molecular weight of 471.73 g/mol. Its IUPAC name is (2S,4aS,6aS,6aS,6bR,10S,12aR,14bR)-8a-amino-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,10,11,12,13,14b-dodecahydro-1H-picene-2-carboxylic acid.
| Compound Name | (2S,4aS,6aS,6aS,6bR,10S,12aR,14bR)-8a-amino-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,10,11,12,13,14b-dodecahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 145271364 |
| Molecular Formula | C30H49NO3 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.37 |
| IUPAC Name | (2S,4aS,6aS,6aS,6bR,10S,12aR,14bR)-8a-amino-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,10,11,12,13,14b-dodecahydro-1H-picene-2-carboxylic acid |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@@](C)(C(=O)O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CCC12N |
| InChI | InChI=1S/C30H49NO3/c1-24(2)22(32)10-11-29(7)21-9-8-19-20-18-26(4,23(33)34)13-12-25(20,3)14-15-27(19,5)28(21,6)16-17-30(24,29)31/h8,20-22,32H,9-18,31H2,1-7H3,(H,33,34)/t20-,21-,22-,25+,26-,27+,28+,29+,30?/m0/s1 |
| InChIKey | LRGDYHLXONVHAI-DZVQTEQPSA-N |
| XLogP | 6.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|