C30H44O4 — CID 70594225
(4aS,6aR,6aS,6bR,12aR,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,11-dioxo-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-2-carboxylic acid (PubChem CID 70594225) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (4aS,6aR,6aS,6bR,12aR,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,11-dioxo-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-2-carboxylic acid.
| Compound Name | (4aS,6aR,6aS,6bR,12aR,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,11-dioxo-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-2-carboxylic acid |
|---|---|
| PubChem CID | 70594225 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (4aS,6aR,6aS,6bR,12aR,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,11-dioxo-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC(=O)C(=O)C(C)(C)C5CC[C@]43C)[C@H]2C1 |
| InChI | InChI=1S/C30H44O4/c1-25(2)21-10-11-30(7)22(28(21,5)17-20(31)23(25)32)9-8-18-19-16-27(4,24(33)34)13-12-26(19,3)14-15-29(18,30)6/h8,19,21-22H,9-17H2,1-7H3,(H,33,34)/t19-,21?,22-,26-,27?,28+,29-,30-/m1/s1 |
| InChIKey | KWXFUNFTSUOFPX-AVLAQQLGSA-N |
| XLogP | 6.62 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|