C15H25F2N3O6 — CID 145274404
4-amino-1-[3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;tert-butyl formate;methanol (PubChem CID 145274404) has the molecular formula C15H25F2N3O6 and a molecular weight of 381.38 g/mol. Its IUPAC name is 4-amino-1-[3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;tert-butyl formate;methanol.
| Compound Name | 4-amino-1-[3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;tert-butyl formate;methanol |
|---|---|
| PubChem CID | 145274404 |
| Molecular Formula | C15H25F2N3O6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-amino-1-[3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;tert-butyl formate;methanol |
| SMILES | CC(C)(C)OC=O.CO.Nc1ccn(C2OC(CO)CC2(F)F)c(=O)n1 |
| InChI | InChI=1S/C9H11F2N3O3.C5H10O2.CH4O/c10-9(11)3-5(4-15)17-7(9)14-2-1-6(12)13-8(14)16;1-5(2,3)7-4-6;1-2/h1-2,5,7,15H,3-4H2,(H2,12,13,16);4H,1-3H3;2H,1H3 |
| InChIKey | RTARIQWGELKLPD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|