C15H19F2N5O3 — CID 162568965
4-amino-1-[(2R)-5-[[3-(aminomethylidene)-4-oxopiperidin-1-yl]methyl]-3,3-difluorooxolan-2-yl]pyrimidin-2-one (PubChem CID 162568965) has the molecular formula C15H19F2N5O3 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-amino-1-[(2R)-5-[[3-(aminomethylidene)-4-oxopiperidin-1-yl]methyl]-3,3-difluorooxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R)-5-[[3-(aminomethylidene)-4-oxopiperidin-1-yl]methyl]-3,3-difluorooxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 162568965 |
| Molecular Formula | C15H19F2N5O3 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-amino-1-[(2R)-5-[[3-(aminomethylidene)-4-oxopiperidin-1-yl]methyl]-3,3-difluorooxolan-2-yl]pyrimidin-2-one |
| SMILES | NC=C1CN(CC2CC(F)(F)[C@H](n3ccc(N)nc3=O)O2)CCC1=O |
| InChI | InChI=1S/C15H19F2N5O3/c16-15(17)5-10(8-21-3-1-11(23)9(6-18)7-21)25-13(15)22-4-2-12(19)20-14(22)24/h2,4,6,10,13H,1,3,5,7-8,18H2,(H2,19,20,24)/t10?,13-/m1/s1 |
| InChIKey | KUZAZEBKMVUJBG-JLOHTSLTSA-N |
| XLogP | -0.13 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|