C13H17F5N4O2 — CID 162557101
4-amino-1-[(2R,5S)-3,3-difluoro-5-[(4,4,4-trifluorobutylamino)methyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 162557101) has the molecular formula C13H17F5N4O2 and a molecular weight of 356.30 g/mol. Its IUPAC name is 4-amino-1-[(2R,5S)-3,3-difluoro-5-[(4,4,4-trifluorobutylamino)methyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5S)-3,3-difluoro-5-[(4,4,4-trifluorobutylamino)methyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 162557101 |
| Molecular Formula | C13H17F5N4O2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-amino-1-[(2R,5S)-3,3-difluoro-5-[(4,4,4-trifluorobutylamino)methyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2O[C@H](CNCCCC(F)(F)F)CC2(F)F)c(=O)n1 |
| InChI | InChI=1S/C13H17F5N4O2/c14-12(15)6-8(7-20-4-1-3-13(16,17)18)24-10(12)22-5-2-9(19)21-11(22)23/h2,5,8,10,20H,1,3-4,6-7H2,(H2,19,21,23)/t8-,10+/m0/s1 |
| InChIKey | ORFLINVSSNBYBF-WCBMZHEXSA-N |
| XLogP | 1.68 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|