About 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane
6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane (PubChem CID 145274731) has the molecular formula C18H24FN3O
and a molecular weight of 317.41 g/mol. Its IUPAC name is 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane.
Molecular Properties
| Compound Name | 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane |
| PubChem CID | 145274731 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane |
| SMILES | CC1CCC1.Nc1n[nH]c2cc(OCC3C=CCC3)cc(F)c12 |
| InChI | InChI=1S/C13H14FN3O.C5H10/c14-10-5-9(18-7-8-3-1-2-4-8)6-11-12(10)13(15)17-16-11;1-5-3-2-4-5/h1,3,5-6,8H,2,4,7H2,(H3,15,16,17);5H,2-4H2,1H3 |
| InChIKey | XCZOCAZJXSUIME-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane?
The IUPAC name of 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane (CID 145274731) is 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane.
What is the SMILES notation for 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane?
The canonical SMILES for 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane is CC1CCC1.Nc1n[nH]c2cc(OCC3C=CCC3)cc(F)c12.
What is the InChIKey of 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane?
The InChIKey is XCZOCAZJXSUIME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3O.C5H10/c14-10-5-9(18-7-8-3-1-2-4-8)6-11-12(10)13(15)17-16-11;1-5-3-2-4-5/h1,3,5-6,8H,2,4,7H2,(H3,15,16,17);5H,2-4H2,1H3.
What are the key properties of 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane?
6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane has a molecular weight of 317.41 g/mol, XLogP of 4.44, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclopent-2-en-1-ylmethoxy)-4-fluoro-1H-indazol-3-amine;methylcyclobutane is sourced from PubChem (CID 145274731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).