C13H16FN3O — CID 145274776
6-(cyclopentylmethoxy)-4-fluoro-1H-indazol-3-amine (PubChem CID 145274776) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is 6-(cyclopentylmethoxy)-4-fluoro-1H-indazol-3-amine.
| Compound Name | 6-(cyclopentylmethoxy)-4-fluoro-1H-indazol-3-amine |
|---|---|
| PubChem CID | 145274776 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 6-(cyclopentylmethoxy)-4-fluoro-1H-indazol-3-amine |
| SMILES | Nc1n[nH]c2cc(OCC3CCCC3)cc(F)c12 |
| InChI | InChI=1S/C13H16FN3O/c14-10-5-9(18-7-8-3-1-2-4-8)6-11-12(10)13(15)17-16-11/h5-6,8H,1-4,7H2,(H3,15,16,17) |
| InChIKey | CFBYZLDKACXMBE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |