C23H35N5O3S — CID 145274840
7-butoxy-6-tert-butylsulfonyl-N-(4,5-dimethyl-1H-pyrazol-3-yl)quinazolin-4-amine;ethane (PubChem CID 145274840) has the molecular formula C23H35N5O3S and a molecular weight of 461.63 g/mol. Its IUPAC name is 7-butoxy-6-tert-butylsulfonyl-N-(4,5-dimethyl-1H-pyrazol-3-yl)quinazolin-4-amine;ethane.
| Compound Name | 7-butoxy-6-tert-butylsulfonyl-N-(4,5-dimethyl-1H-pyrazol-3-yl)quinazolin-4-amine;ethane |
|---|---|
| PubChem CID | 145274840 |
| Molecular Formula | C23H35N5O3S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 7-butoxy-6-tert-butylsulfonyl-N-(4,5-dimethyl-1H-pyrazol-3-yl)quinazolin-4-amine;ethane |
| SMILES | CC.CCCCOc1cc2ncnc(Nc3n[nH]c(C)c3C)c2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C21H29N5O3S.C2H6/c1-7-8-9-29-17-11-16-15(10-18(17)30(27,28)21(4,5)6)20(23-12-22-16)24-19-13(2)14(3)25-26-19;1-2/h10-12H,7-9H2,1-6H3,(H2,22,23,24,25,26);1-2H3 |
| InChIKey | MBYQGFRYAZYFQR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|