C33H40O4 — CID 145275873
[3-ethoxy-5-[2-ethyl-4-[2-(4-heptylphenyl)ethynyl]phenyl]phenoxy]methoxymethanol (PubChem CID 145275873) has the molecular formula C33H40O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is [3-ethoxy-5-[2-ethyl-4-[2-(4-heptylphenyl)ethynyl]phenyl]phenoxy]methoxymethanol.
| Compound Name | [3-ethoxy-5-[2-ethyl-4-[2-(4-heptylphenyl)ethynyl]phenyl]phenoxy]methoxymethanol |
|---|---|
| PubChem CID | 145275873 |
| Molecular Formula | C33H40O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | [3-ethoxy-5-[2-ethyl-4-[2-(4-heptylphenyl)ethynyl]phenyl]phenoxy]methoxymethanol |
| SMILES | CCCCCCCc1ccc(C#Cc2ccc(-c3cc(OCC)cc(OCOCO)c3)c(CC)c2)cc1 |
| InChI | InChI=1S/C33H40O4/c1-4-7-8-9-10-11-26-12-14-27(15-13-26)16-17-28-18-19-33(29(5-2)20-28)30-21-31(36-6-3)23-32(22-30)37-25-35-24-34/h12-15,18-23,34H,4-11,24-25H2,1-3H3 |
| InChIKey | OPPCRSCNWBZAGV-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|