N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen

C8H21NO2S — CID 145277308

IUPACN-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen
SMILESCCCC[C@@H](C)CNS(C)(=O)=O.[H][H]
InChIInChI=1S/C8H19NO2S.H2/c1-4-5-6-8(2)7-9-12(3,10)11;/h8-9H,4-7H2,1-3H3;1H/t8-;/m1./s1
InChIKeyOXNPXUAMRQFTRT-DDWIOCJRSA-N
MW195.33 g/mol
LogP1.61
Rot. Bonds6

About N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen

N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen (PubChem CID 145277308) has the molecular formula C8H21NO2S and a molecular weight of 195.33 g/mol. Its IUPAC name is N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen.

Molecular Properties

Compound NameN-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen
PubChem CID145277308
Molecular FormulaC8H21NO2S
Molecular Weight195.33 g/mol
Exact Mass195.13
IUPAC NameN-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen
SMILESCCCC[C@@H](C)CNS(C)(=O)=O.[H][H]
InChIInChI=1S/C8H19NO2S.H2/c1-4-5-6-8(2)7-9-12(3,10)11;/h8-9H,4-7H2,1-3H3;1H/t8-;/m1./s1
InChIKeyOXNPXUAMRQFTRT-DDWIOCJRSA-N
XLogP1.61
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.33
LogP ≤ 51.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen?
The IUPAC name of N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen (CID 145277308) is N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen.
What is the SMILES notation for N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen?
The canonical SMILES for N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen is CCCC[C@@H](C)CNS(C)(=O)=O.[H][H].
What is the InChIKey of N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen?
The InChIKey is OXNPXUAMRQFTRT-DDWIOCJRSA-N. The full InChI is InChI=1S/C8H19NO2S.H2/c1-4-5-6-8(2)7-9-12(3,10)11;/h8-9H,4-7H2,1-3H3;1H/t8-;/m1./s1.
What are the key properties of N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen?
N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen has a molecular weight of 195.33 g/mol, XLogP of 1.61, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-methylhexyl]methanesulfonamide;molecular hydrogen is sourced from PubChem (CID 145277308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).