C12H16N2OS — CID 145277518
[2-[(2E,4Z)-6-methoxyhepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methanamine (PubChem CID 145277518) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is [2-[(2E,4Z)-6-methoxyhepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-[(2E,4Z)-6-methoxyhepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 145277518 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [2-[(2E,4Z)-6-methoxyhepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methanamine |
| SMILES | C=C(/C=C\C(=C/C)c1ncc(CN)s1)OC |
| InChI | InChI=1S/C12H16N2OS/c1-4-10(6-5-9(2)15-3)12-14-8-11(7-13)16-12/h4-6,8H,2,7,13H2,1,3H3/b6-5-,10-4+ |
| InChIKey | KPOLMRZDUXDKRC-QYONPMAVSA-N |
| XLogP | 2.72 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|