C25H20N4O2S2 — CID 145277719
(11Z)-11-ethylidene-6-oxo-N-[(2-pyridin-4-yl-1,3-thiazol-5-yl)methyl]-5H-benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 145277719) has the molecular formula C25H20N4O2S2 and a molecular weight of 472.60 g/mol. Its IUPAC name is (11Z)-11-ethylidene-6-oxo-N-[(2-pyridin-4-yl-1,3-thiazol-5-yl)methyl]-5H-benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | (11Z)-11-ethylidene-6-oxo-N-[(2-pyridin-4-yl-1,3-thiazol-5-yl)methyl]-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 145277719 |
| Molecular Formula | C25H20N4O2S2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (11Z)-11-ethylidene-6-oxo-N-[(2-pyridin-4-yl-1,3-thiazol-5-yl)methyl]-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | C/C=S1\c2ccc(C(=O)NCc3cnc(-c4ccncc4)s3)cc2NC(=O)c2ccccc21 |
| InChI | InChI=1S/C25H20N4O2S2/c1-2-33-21-6-4-3-5-19(21)24(31)29-20-13-17(7-8-22(20)33)23(30)27-14-18-15-28-25(32-18)16-9-11-26-12-10-16/h2-13,15H,14H2,1H3,(H,27,30)(H,29,31) |
| InChIKey | YMOIRHBBXXXYSA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|