C10H12O3S — CID 14527803
S-benzyl (2R)-2,3-dihydroxypropanethioate (PubChem CID 14527803) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is S-benzyl (2R)-2,3-dihydroxypropanethioate.
| Compound Name | S-benzyl (2R)-2,3-dihydroxypropanethioate |
|---|---|
| PubChem CID | 14527803 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | S-benzyl (2R)-2,3-dihydroxypropanethioate |
| SMILES | O=C(SCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C10H12O3S/c11-6-9(12)10(13)14-7-8-4-2-1-3-5-8/h1-5,9,11-12H,6-7H2/t9-/m1/s1 |
| InChIKey | KAIPTHGKBJJKDN-SECBINFHSA-N |
| XLogP | 0.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|