C12H11Br2NO2 — CID 145281378
5,7-dibromo-8-hydroxyquinoline-2-carbaldehyde;ethane (PubChem CID 145281378) has the molecular formula C12H11Br2NO2 and a molecular weight of 361.03 g/mol. Its IUPAC name is 5,7-dibromo-8-hydroxyquinoline-2-carbaldehyde;ethane.
| Compound Name | 5,7-dibromo-8-hydroxyquinoline-2-carbaldehyde;ethane |
|---|---|
| PubChem CID | 145281378 |
| Molecular Formula | C12H11Br2NO2 |
| Molecular Weight | 361.03 g/mol |
| Exact Mass | 358.92 |
| IUPAC Name | 5,7-dibromo-8-hydroxyquinoline-2-carbaldehyde;ethane |
| SMILES | CC.O=Cc1ccc2c(Br)cc(Br)c(O)c2n1 |
| InChI | InChI=1S/C10H5Br2NO2.C2H6/c11-7-3-8(12)10(15)9-6(7)2-1-5(4-14)13-9;1-2/h1-4,15H;1-2H3 |
| InChIKey | ZNANUVWZIOOCOB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.03 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|