C17H18N2O3 — CID 142879404
ethane;5-hydroxy-4,7-phenanthroline-3,8-dicarbaldehyde;methane (PubChem CID 142879404) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethane;5-hydroxy-4,7-phenanthroline-3,8-dicarbaldehyde;methane.
| Compound Name | ethane;5-hydroxy-4,7-phenanthroline-3,8-dicarbaldehyde;methane |
|---|---|
| PubChem CID | 142879404 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | ethane;5-hydroxy-4,7-phenanthroline-3,8-dicarbaldehyde;methane |
| SMILES | C.CC.O=Cc1ccc2c(cc(O)c3nc(C=O)ccc32)n1 |
| InChI | InChI=1S/C14H8N2O3.C2H6.CH4/c17-6-8-1-3-10-11-4-2-9(7-18)16-14(11)13(19)5-12(10)15-8;1-2;/h1-7,19H;1-2H3;1H4 |
| InChIKey | IWVJEACZXOGPDC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|