C7H12N2S — CID 145284132
1,4,6-trimethyl-2H-pyrimidine-2-thiol (PubChem CID 145284132) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 1,4,6-trimethyl-2H-pyrimidine-2-thiol.
| Compound Name | 1,4,6-trimethyl-2H-pyrimidine-2-thiol |
|---|---|
| PubChem CID | 145284132 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 1,4,6-trimethyl-2H-pyrimidine-2-thiol |
| SMILES | CC1=CC(C)=NC(S)N1C |
| InChI | InChI=1S/C7H12N2S/c1-5-4-6(2)9(3)7(10)8-5/h4,7,10H,1-3H3 |
| InChIKey | HKUWHBYTKSOBNG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|