C12H22N2 — CID 145285267
(E)-N-ethyl-3-piperidin-2-ylpent-2-en-1-imine (PubChem CID 145285267) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (E)-N-ethyl-3-piperidin-2-ylpent-2-en-1-imine.
| Compound Name | (E)-N-ethyl-3-piperidin-2-ylpent-2-en-1-imine |
|---|---|
| PubChem CID | 145285267 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (E)-N-ethyl-3-piperidin-2-ylpent-2-en-1-imine |
| SMILES | CC/N=C/C=C(\CC)C1CCCCN1 |
| InChI | InChI=1S/C12H22N2/c1-3-11(8-10-13-4-2)12-7-5-6-9-14-12/h8,10,12,14H,3-7,9H2,1-2H3/b11-8+,13-10+ |
| InChIKey | QJLFALJBVNJALV-QLVLWNPDSA-N |
| XLogP | 2.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|