C18H35N3O4 — CID 145285909
1-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-N'-methylmethanediamine;ethane (PubChem CID 145285909) has the molecular formula C18H35N3O4 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-N'-methylmethanediamine;ethane.
| Compound Name | 1-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-N'-methylmethanediamine;ethane |
|---|---|
| PubChem CID | 145285909 |
| Molecular Formula | C18H35N3O4 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.26 |
| IUPAC Name | 1-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-N'-methylmethanediamine;ethane |
| SMILES | CC.CNC(N)c1ccc(OCCOCCOCCOCCN)cc1 |
| InChI | InChI=1S/C16H29N3O4.C2H6/c1-19-16(18)14-2-4-15(5-3-14)23-13-12-22-11-10-21-9-8-20-7-6-17;1-2/h2-5,16,19H,6-13,17-18H2,1H3;1-2H3 |
| InChIKey | MQTYBDNOROJDNY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|