C24H44N2O10 — CID 177015138
N-[4-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]hydroxylamine (PubChem CID 177015138) has the molecular formula C24H44N2O10 and a molecular weight of 520.62 g/mol. Its IUPAC name is N-[4-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]hydroxylamine.
| Compound Name | N-[4-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]hydroxylamine |
|---|---|
| PubChem CID | 177015138 |
| Molecular Formula | C24H44N2O10 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | N-[4-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]hydroxylamine |
| SMILES | NCCOCCOCCOCCOCCOCCOCCOCCOCCOc1ccc(NO)cc1 |
| InChI | InChI=1S/C24H44N2O10/c25-5-6-28-7-8-29-9-10-30-11-12-31-13-14-32-15-16-33-17-18-34-19-20-35-21-22-36-24-3-1-23(26-27)2-4-24/h1-4,26-27H,5-22,25H2 |
| InChIKey | XLVBDJGNVAKVRM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|