C24H27NO5 — CID 102054995
3-[4-[2-(2-aminoethoxy)ethoxy]phenyl]-6-(4-hydroxyphenyl)-4,5-dimethylbenzene-1,2-diol (PubChem CID 102054995) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 3-[4-[2-(2-aminoethoxy)ethoxy]phenyl]-6-(4-hydroxyphenyl)-4,5-dimethylbenzene-1,2-diol.
| Compound Name | 3-[4-[2-(2-aminoethoxy)ethoxy]phenyl]-6-(4-hydroxyphenyl)-4,5-dimethylbenzene-1,2-diol |
|---|---|
| PubChem CID | 102054995 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 3-[4-[2-(2-aminoethoxy)ethoxy]phenyl]-6-(4-hydroxyphenyl)-4,5-dimethylbenzene-1,2-diol |
| SMILES | Cc1c(C)c(-c2ccc(OCCOCCN)cc2)c(O)c(O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-15-16(2)22(18-5-9-20(10-6-18)30-14-13-29-12-11-25)24(28)23(27)21(15)17-3-7-19(26)8-4-17/h3-10,26-28H,11-14,25H2,1-2H3 |
| InChIKey | WZSOPJZWJYSGQR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|