C29H49NO3 — CID 145286524
2-[(4E)-9-ethyl-4,8-dimethylcyclodec-4-en-1-yl]acetaldehyde;methoxymethane;N-methyl-2-phenylmethoxyprop-2-en-1-amine (PubChem CID 145286524) has the molecular formula C29H49NO3 and a molecular weight of 459.72 g/mol. Its IUPAC name is 2-[(4E)-9-ethyl-4,8-dimethylcyclodec-4-en-1-yl]acetaldehyde;methoxymethane;N-methyl-2-phenylmethoxyprop-2-en-1-amine.
| Compound Name | 2-[(4E)-9-ethyl-4,8-dimethylcyclodec-4-en-1-yl]acetaldehyde;methoxymethane;N-methyl-2-phenylmethoxyprop-2-en-1-amine |
|---|---|
| PubChem CID | 145286524 |
| Molecular Formula | C29H49NO3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | 2-[(4E)-9-ethyl-4,8-dimethylcyclodec-4-en-1-yl]acetaldehyde;methoxymethane;N-methyl-2-phenylmethoxyprop-2-en-1-amine |
| SMILES | C=C(CNC)OCc1ccccc1.CCC1CC(CC=O)CC/C(C)=C/CCC1C.COC |
| InChI | InChI=1S/C16H28O.C11H15NO.C2H6O/c1-4-16-12-15(10-11-17)9-8-13(2)6-5-7-14(16)3;1-10(8-12-2)13-9-11-6-4-3-5-7-11;1-3-2/h6,11,14-16H,4-5,7-10,12H2,1-3H3;3-7,12H,1,8-9H2,2H3;1-2H3/b13-6+;; |
| InChIKey | QNWIGDPFVSMUER-JNXPPIHMSA-N |
| XLogP | 6.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|