C17H24O2 — CID 58431277
benzyl (1S,2S,4R)-4-ethyl-2-methylcyclohexane-1-carboxylate (PubChem CID 58431277) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is benzyl (1S,2S,4R)-4-ethyl-2-methylcyclohexane-1-carboxylate.
| Compound Name | benzyl (1S,2S,4R)-4-ethyl-2-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58431277 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | benzyl (1S,2S,4R)-4-ethyl-2-methylcyclohexane-1-carboxylate |
| SMILES | CC[C@@H]1CC[C@H](C(=O)OCc2ccccc2)[C@@H](C)C1 |
| InChI | InChI=1S/C17H24O2/c1-3-14-9-10-16(13(2)11-14)17(18)19-12-15-7-5-4-6-8-15/h4-8,13-14,16H,3,9-12H2,1-2H3/t13-,14+,16-/m0/s1 |
| InChIKey | VTBMABMKUJNUID-LZWOXQAQSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |