C19H30FN3O2 — CID 145287461
ethane;N-[(E)-2-(4-fluorophenyl)ethenyl]-4-formylpiperazine-1-carboxamide;propane (PubChem CID 145287461) has the molecular formula C19H30FN3O2 and a molecular weight of 351.47 g/mol. Its IUPAC name is ethane;N-[(E)-2-(4-fluorophenyl)ethenyl]-4-formylpiperazine-1-carboxamide;propane.
| Compound Name | ethane;N-[(E)-2-(4-fluorophenyl)ethenyl]-4-formylpiperazine-1-carboxamide;propane |
|---|---|
| PubChem CID | 145287461 |
| Molecular Formula | C19H30FN3O2 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | ethane;N-[(E)-2-(4-fluorophenyl)ethenyl]-4-formylpiperazine-1-carboxamide;propane |
| SMILES | CC.CCC.O=CN1CCN(C(=O)N/C=C/c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H16FN3O2.C3H8.C2H6/c15-13-3-1-12(2-4-13)5-6-16-14(20)18-9-7-17(11-19)8-10-18;1-3-2;1-2/h1-6,11H,7-10H2,(H,16,20);3H2,1-2H3;1-2H3/b6-5+;; |
| InChIKey | UPKSXGAHBOAQHT-TXOOBNKBSA-N |
| XLogP | 3.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|