C35H40N6O — CID 145287713
2-[2-[4-[(4-amino-5-phenylpyrimidin-2-yl)amino]phenyl]ethynyl]-N-cyclopropylpyridine-4-carboxamide;cyclohexane;ethane (PubChem CID 145287713) has the molecular formula C35H40N6O and a molecular weight of 560.75 g/mol. Its IUPAC name is 2-[2-[4-[(4-amino-5-phenylpyrimidin-2-yl)amino]phenyl]ethynyl]-N-cyclopropylpyridine-4-carboxamide;cyclohexane;ethane.
| Compound Name | 2-[2-[4-[(4-amino-5-phenylpyrimidin-2-yl)amino]phenyl]ethynyl]-N-cyclopropylpyridine-4-carboxamide;cyclohexane;ethane |
|---|---|
| PubChem CID | 145287713 |
| Molecular Formula | C35H40N6O |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | 2-[2-[4-[(4-amino-5-phenylpyrimidin-2-yl)amino]phenyl]ethynyl]-N-cyclopropylpyridine-4-carboxamide;cyclohexane;ethane |
| SMILES | C1CCCCC1.CC.Nc1nc(Nc2ccc(C#Cc3cc(C(=O)NC4CC4)ccn3)cc2)ncc1-c1ccccc1 |
| InChI | InChI=1S/C27H22N6O.C6H12.C2H6/c28-25-24(19-4-2-1-3-5-19)17-30-27(33-25)32-22-9-6-18(7-10-22)8-11-23-16-20(14-15-29-23)26(34)31-21-12-13-21;1-2-4-6-5-3-1;1-2/h1-7,9-10,14-17,21H,12-13H2,(H,31,34)(H3,28,30,32,33);1-6H2;1-2H3 |
| InChIKey | AONLAIFCFRKWHG-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|