C28H27ClN6 — CID 145287666
2-N-[4-[2-(4-chloro-2-pyridinyl)ethynyl]phenyl]-5-pyridin-2-ylpyrimidine-2,4-diamine;cyclohexane (PubChem CID 145287666) has the molecular formula C28H27ClN6 and a molecular weight of 483.02 g/mol. Its IUPAC name is 2-N-[4-[2-(4-chloro-2-pyridinyl)ethynyl]phenyl]-5-pyridin-2-ylpyrimidine-2,4-diamine;cyclohexane.
| Compound Name | 2-N-[4-[2-(4-chloro-2-pyridinyl)ethynyl]phenyl]-5-pyridin-2-ylpyrimidine-2,4-diamine;cyclohexane |
|---|---|
| PubChem CID | 145287666 |
| Molecular Formula | C28H27ClN6 |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-N-[4-[2-(4-chloro-2-pyridinyl)ethynyl]phenyl]-5-pyridin-2-ylpyrimidine-2,4-diamine;cyclohexane |
| SMILES | C1CCCCC1.Nc1nc(Nc2ccc(C#Cc3cc(Cl)ccn3)cc2)ncc1-c1ccccn1 |
| InChI | InChI=1S/C22H15ClN6.C6H12/c23-16-10-12-25-18(13-16)9-6-15-4-7-17(8-5-15)28-22-27-14-19(21(24)29-22)20-3-1-2-11-26-20;1-2-4-6-5-3-1/h1-5,7-8,10-14H,(H3,24,27,28,29);1-6H2 |
| InChIKey | KJPVULQBHSEICA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|