C39H46FN7O2S — CID 145287718
cyclohexane;2-[2-[4-[[5-(2-fluoro-4-morpholin-4-ylsulfanylphenyl)-4-(methylamino)pyrimidin-2-yl]amino]phenyl]ethynyl]pyridine-4-carbaldehyde;N-methylcyclopropanamine (PubChem CID 145287718) has the molecular formula C39H46FN7O2S and a molecular weight of 695.91 g/mol. Its IUPAC name is cyclohexane;2-[2-[4-[[5-(2-fluoro-4-morpholin-4-ylsulfanylphenyl)-4-(methylamino)pyrimidin-2-yl]amino]phenyl]ethynyl]pyridine-4-carbaldehyde;N-methylcyclopropanamine.
| Compound Name | cyclohexane;2-[2-[4-[[5-(2-fluoro-4-morpholin-4-ylsulfanylphenyl)-4-(methylamino)pyrimidin-2-yl]amino]phenyl]ethynyl]pyridine-4-carbaldehyde;N-methylcyclopropanamine |
|---|---|
| PubChem CID | 145287718 |
| Molecular Formula | C39H46FN7O2S |
| Molecular Weight | 695.91 g/mol |
| Exact Mass | 695.34 |
| IUPAC Name | cyclohexane;2-[2-[4-[[5-(2-fluoro-4-morpholin-4-ylsulfanylphenyl)-4-(methylamino)pyrimidin-2-yl]amino]phenyl]ethynyl]pyridine-4-carbaldehyde;N-methylcyclopropanamine |
| SMILES | C1CCCCC1.CNC1CC1.CNc1nc(Nc2ccc(C#Cc3cc(C=O)ccn3)cc2)ncc1-c1ccc(SN2CCOCC2)cc1F |
| InChI | InChI=1S/C29H25FN6O2S.C6H12.C4H9N/c1-31-28-26(25-9-8-24(17-27(25)30)39-36-12-14-38-15-13-36)18-33-29(35-28)34-22-5-2-20(3-6-22)4-7-23-16-21(19-37)10-11-32-23;1-2-4-6-5-3-1;1-5-4-2-3-4/h2-3,5-6,8-11,16-19H,12-15H2,1H3,(H2,31,33,34,35);1-6H2;4-5H,2-3H2,1H3 |
| InChIKey | GTUCPURNNKEABD-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.91 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|