C29H32N6O — CID 145287763
(Z,2E)-6-[4-[[4-amino-5-(cyclohexen-1-yl)pyrimidin-2-yl]amino]phenyl]-N-cyclopropyl-2-ethylidene-4-(ethylideneamino)hex-3-en-5-ynamide (PubChem CID 145287763) has the molecular formula C29H32N6O and a molecular weight of 480.62 g/mol. Its IUPAC name is (Z,2E)-6-[4-[[4-amino-5-(cyclohexen-1-yl)pyrimidin-2-yl]amino]phenyl]-N-cyclopropyl-2-ethylidene-4-(ethylideneamino)hex-3-en-5-ynamide.
| Compound Name | (Z,2E)-6-[4-[[4-amino-5-(cyclohexen-1-yl)pyrimidin-2-yl]amino]phenyl]-N-cyclopropyl-2-ethylidene-4-(ethylideneamino)hex-3-en-5-ynamide |
|---|---|
| PubChem CID | 145287763 |
| Molecular Formula | C29H32N6O |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | (Z,2E)-6-[4-[[4-amino-5-(cyclohexen-1-yl)pyrimidin-2-yl]amino]phenyl]-N-cyclopropyl-2-ethylidene-4-(ethylideneamino)hex-3-en-5-ynamide |
| SMILES | C/C=N/C(C#Cc1ccc(Nc2ncc(C3=CCCCC3)c(N)n2)cc1)=C\C(=C/C)C(=O)NC1CC1 |
| InChI | InChI=1S/C29H32N6O/c1-3-21(28(36)33-23-16-17-23)18-25(31-4-2)15-12-20-10-13-24(14-11-20)34-29-32-19-26(27(30)35-29)22-8-6-5-7-9-22/h3-4,8,10-11,13-14,18-19,23H,5-7,9,16-17H2,1-2H3,(H,33,36)(H3,30,32,34,35)/b21-3+,25-18-,31-4+ |
| InChIKey | RNXVPZXGOJZJLQ-NQDOPORHSA-N |
| XLogP | 5.31 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|