C20H24FN7 — CID 163280605
4-N-(5-amino-2-fluorophenyl)-2-N-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-5-(cyclohexen-1-yl)pyrimidine-2,4-diamine (PubChem CID 163280605) has the molecular formula C20H24FN7 and a molecular weight of 381.46 g/mol. Its IUPAC name is 4-N-(5-amino-2-fluorophenyl)-2-N-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-5-(cyclohexen-1-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(5-amino-2-fluorophenyl)-2-N-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-5-(cyclohexen-1-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163280605 |
| Molecular Formula | C20H24FN7 |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-N-(5-amino-2-fluorophenyl)-2-N-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-5-(cyclohexen-1-yl)pyrimidine-2,4-diamine |
| SMILES | C/N=C/C(=C\N)Nc1ncc(C2=CCCCC2)c(Nc2cc(N)ccc2F)n1 |
| InChI | InChI=1S/C20H24FN7/c1-24-11-15(10-22)26-20-25-12-16(13-5-3-2-4-6-13)19(28-20)27-18-9-14(23)7-8-17(18)21/h5,7-12H,2-4,6,22-23H2,1H3,(H2,25,26,27,28)/b15-10+,24-11+ |
| InChIKey | MBZKXZYCCLDUQX-FMGBSETESA-N |
| XLogP | 3.81 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|