C26H27F3N8O — CID 163280695
N-[3-[[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]-4-(dimethylamino)phenyl]prop-2-enamide (PubChem CID 163280695) has the molecular formula C26H27F3N8O and a molecular weight of 524.55 g/mol. Its IUPAC name is N-[3-[[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]-4-(dimethylamino)phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]-4-(dimethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163280695 |
| Molecular Formula | C26H27F3N8O |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | N-[3-[[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]-4-(dimethylamino)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(N(C)C)c(Nc2nc(NC(/C=N/C)=C/N)ncc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C26H27F3N8O/c1-5-23(38)33-18-10-11-22(37(3)4)21(12-18)35-24-20(16-6-8-17(9-7-16)26(27,28)29)15-32-25(36-24)34-19(13-30)14-31-2/h5-15H,1,30H2,2-4H3,(H,33,38)(H2,32,34,35,36)/b19-13+,31-14+ |
| InChIKey | ROYZHIYARUOAPP-XEDIAAEFSA-N |
| XLogP | 5.01 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|