C25H22ClF2N7O2 — CID 163281439
N-[3-[[2-[[1-amino-3-(oxetan-3-ylimino)prop-1-en-2-yl]amino]-5-(3-chloro-4-fluorophenyl)pyrimidin-4-yl]amino]-4-fluorophenyl]prop-2-enamide (PubChem CID 163281439) has the molecular formula C25H22ClF2N7O2 and a molecular weight of 525.95 g/mol. Its IUPAC name is N-[3-[[2-[[1-amino-3-(oxetan-3-ylimino)prop-1-en-2-yl]amino]-5-(3-chloro-4-fluorophenyl)pyrimidin-4-yl]amino]-4-fluorophenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[[1-amino-3-(oxetan-3-ylimino)prop-1-en-2-yl]amino]-5-(3-chloro-4-fluorophenyl)pyrimidin-4-yl]amino]-4-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163281439 |
| Molecular Formula | C25H22ClF2N7O2 |
| Molecular Weight | 525.95 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | N-[3-[[2-[[1-amino-3-(oxetan-3-ylimino)prop-1-en-2-yl]amino]-5-(3-chloro-4-fluorophenyl)pyrimidin-4-yl]amino]-4-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(Nc2nc(NC(=CN)/C=N/C3COC3)ncc2-c2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H22ClF2N7O2/c1-2-23(36)32-15-4-6-21(28)22(8-15)34-24-18(14-3-5-20(27)19(26)7-14)11-31-25(35-24)33-16(9-29)10-30-17-12-37-13-17/h2-11,17H,1,12-13,29H2,(H,32,36)(H2,31,33,34,35)/b16-9?,30-10+ |
| InChIKey | XPEKIFWBFUUQJI-NMSYVATQSA-N |
| XLogP | 4.62 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.95 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|