C26H23FN8O — CID 174004997
N-[3-[[2-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]-5-quinolin-7-ylpyrimidin-4-yl]amino]-4-fluorophenyl]prop-2-enamide (PubChem CID 174004997) has the molecular formula C26H23FN8O and a molecular weight of 482.52 g/mol. Its IUPAC name is N-[3-[[2-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]-5-quinolin-7-ylpyrimidin-4-yl]amino]-4-fluorophenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]-5-quinolin-7-ylpyrimidin-4-yl]amino]-4-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 174004997 |
| Molecular Formula | C26H23FN8O |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[3-[[2-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]-5-quinolin-7-ylpyrimidin-4-yl]amino]-4-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(Nc2nc(NC(=CN)/C=N/C)ncc2-c2ccc3cccnc3c2)c1 |
| InChI | InChI=1S/C26H23FN8O/c1-3-24(36)32-18-8-9-21(27)23(12-18)34-25-20(15-31-26(35-25)33-19(13-28)14-29-2)17-7-6-16-5-4-10-30-22(16)11-17/h3-15H,1,28H2,2H3,(H,32,36)(H2,31,33,34,35)/b19-13?,29-14+ |
| InChIKey | JCPSMMIAOXIFPG-MPVBMTQJSA-N |
| XLogP | 4.61 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|